C15H16F6O5S — CID 87739419
[3-(trifluoromethylsulfonyloxy)-1-adamantyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 87739419) has the molecular formula C15H16F6O5S and a molecular weight of 422.34 g/mol. Its IUPAC name is [3-(trifluoromethylsulfonyloxy)-1-adamantyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-(trifluoromethylsulfonyloxy)-1-adamantyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87739419 |
| Molecular Formula | C15H16F6O5S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | [3-(trifluoromethylsulfonyloxy)-1-adamantyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC12CC3CC(C1)CC(OS(=O)(=O)C(F)(F)F)(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C15H16F6O5S/c1-8(14(16,17)18)11(22)25-12-3-9-2-10(4-12)6-13(5-9,7-12)26-27(23,24)15(19,20)21/h9-10H,1-7H2 |
| InChIKey | KRQLOGWGNNFQRW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|