C21H26O5S — CID 87739113
[3-(2-methylphenyl)sulfonyloxy-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 87739113) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is [3-(2-methylphenyl)sulfonyloxy-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-methylphenyl)sulfonyloxy-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87739113 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [3-(2-methylphenyl)sulfonyloxy-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(OS(=O)(=O)c1ccccc1C)(C3)C2 |
| InChI | InChI=1S/C21H26O5S/c1-14(2)19(22)25-20-9-16-8-17(10-20)12-21(11-16,13-20)26-27(23,24)18-7-5-4-6-15(18)3/h4-7,16-17H,1,8-13H2,2-3H3 |
| InChIKey | MUJVETRDSPGXFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|