C37H41O5S+ — CID 58491431
[4-[2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 58491431) has the molecular formula C37H41O5S+ and a molecular weight of 597.80 g/mol. Its IUPAC name is [4-[2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58491431 |
| Molecular Formula | C37H41O5S+ |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | [4-[2-[[3-[2-(2-methylprop-2-enoyloxy)propan-2-yl]-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | C=C(C)C(=O)OC(C)(C)C12CC3CC(CC(OC(=O)COc4ccc([S+](c5ccccc5)c5ccccc5)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C37H41O5S/c1-26(2)34(39)42-35(3,4)36-20-27-19-28(21-36)23-37(22-27,25-36)41-33(38)24-40-29-15-17-32(18-16-29)43(30-11-7-5-8-12-30)31-13-9-6-10-14-31/h5-18,27-28H,1,19-25H2,2-4H3/q+1 |
| InChIKey | WFNMOOLHKHLCQR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|