C32H35O5S+ — CID 59602076
[4-[2-[[3-(methoxymethoxy)-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 59602076) has the molecular formula C32H35O5S+ and a molecular weight of 531.69 g/mol. Its IUPAC name is [4-[2-[[3-(methoxymethoxy)-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[[3-(methoxymethoxy)-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59602076 |
| Molecular Formula | C32H35O5S+ |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | [4-[2-[[3-(methoxymethoxy)-1-adamantyl]oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | COCOC12CC3CC(C1)CC(OC(=O)COc1ccc([S+](c4ccccc4)c4ccccc4)cc1)(C3)C2 |
| InChI | InChI=1S/C32H35O5S/c1-34-23-36-31-17-24-16-25(18-31)20-32(19-24,22-31)37-30(33)21-35-26-12-14-29(15-13-26)38(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-15,24-25H,16-23H2,1H3/q+1 |
| InChIKey | UVNOALJMVXAFMZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|