C26H23O3S+ — CID 169051335
[4-[2-(1-ethynylcyclobutyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169051335) has the molecular formula C26H23O3S+ and a molecular weight of 415.53 g/mol. Its IUPAC name is [4-[2-(1-ethynylcyclobutyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(1-ethynylcyclobutyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169051335 |
| Molecular Formula | C26H23O3S+ |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [4-[2-(1-ethynylcyclobutyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | C#CC1(OC(=O)COc2ccc([S+](c3ccccc3)c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C26H23O3S/c1-2-26(18-9-19-26)29-25(27)20-28-21-14-16-24(17-15-21)30(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h1,3-8,10-17H,9,18-20H2/q+1 |
| InChIKey | UXRDCHWTOXIULA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|