C32H26F3O3S+ — CID 169017508
[4-[2-oxo-2-[1-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-yl]oxyethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017508) has the molecular formula C32H26F3O3S+ and a molecular weight of 547.62 g/mol. Its IUPAC name is [4-[2-oxo-2-[1-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-yl]oxyethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-oxo-2-[1-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-yl]oxyethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017508 |
| Molecular Formula | C32H26F3O3S+ |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | [4-[2-oxo-2-[1-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-yl]oxyethoxy]phenyl]-diphenylsulfanium |
| SMILES | O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OC1(c2ccc(C(F)(F)F)cc2)C=CCC1 |
| InChI | InChI=1S/C32H26F3O3S/c33-32(34,35)25-15-13-24(14-16-25)31(21-7-8-22-31)38-30(36)23-37-26-17-19-29(20-18-26)39(27-9-3-1-4-10-27)28-11-5-2-6-12-28/h1-7,9-21H,8,22-23H2/q+1 |
| InChIKey | VTMNGYKACVAIBI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|