C27H23F2O3S+ — CID 169051567
(3,5-difluorophenyl)-[4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium (PubChem CID 169051567) has the molecular formula C27H23F2O3S+ and a molecular weight of 465.54 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium.
| Compound Name | (3,5-difluorophenyl)-[4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 169051567 |
| Molecular Formula | C27H23F2O3S+ |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (3,5-difluorophenyl)-[4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]phenyl]-phenylsulfanium |
| SMILES | C#CC1(OC(=O)COc2ccc([S+](c3ccccc3)c3cc(F)cc(F)c3)cc2)CCCC1 |
| InChI | InChI=1S/C27H23F2O3S/c1-2-27(14-6-7-15-27)32-26(30)19-31-22-10-12-24(13-11-22)33(23-8-4-3-5-9-23)25-17-20(28)16-21(29)18-25/h1,3-5,8-13,16-18H,6-7,14-15,19H2/q+1 |
| InChIKey | MMBCXQWHJGDFLB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|