C29H29O3S+ — CID 169051521
[4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 169051521) has the molecular formula C29H29O3S+ and a molecular weight of 457.62 g/mol. Its IUPAC name is [4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169051521 |
| Molecular Formula | C29H29O3S+ |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [4-[2-(1-ethynylcyclopentyl)oxy-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | C#CC1(OC(=O)COc2c(C)cc([S+](c3ccccc3)c3ccccc3)cc2C)CCCC1 |
| InChI | InChI=1S/C29H29O3S/c1-4-29(17-11-12-18-29)32-27(30)21-31-28-22(2)19-26(20-23(28)3)33(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h1,5-10,13-16,19-20H,11-12,17-18,21H2,2-3H3/q+1 |
| InChIKey | BRDPDOJMMQMQBX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|