C34H35O3S+ — CID 169017261
[4-[2-[2-(2,3-dihydro-1H-inden-2-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 169017261) has the molecular formula C34H35O3S+ and a molecular weight of 523.72 g/mol. Its IUPAC name is [4-[2-[2-(2,3-dihydro-1H-inden-2-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[2-(2,3-dihydro-1H-inden-2-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017261 |
| Molecular Formula | C34H35O3S+ |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | [4-[2-[2-(2,3-dihydro-1H-inden-2-yl)propan-2-yloxy]-2-oxoethoxy]-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC(C)(C)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C34H35O3S/c1-24-19-31(38(29-15-7-5-8-16-29)30-17-9-6-10-18-30)20-25(2)33(24)36-23-32(35)37-34(3,4)28-21-26-13-11-12-14-27(26)22-28/h5-20,28H,21-23H2,1-4H3/q+1 |
| InChIKey | YPPUWECRWHEALD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|