C30H37O3S+ — CID 140622341
bis(4-tert-butylphenyl)-[4-(carboxymethoxy)-3,5-dimethylphenyl]sulfanium (PubChem CID 140622341) has the molecular formula C30H37O3S+ and a molecular weight of 477.69 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[4-(carboxymethoxy)-3,5-dimethylphenyl]sulfanium.
| Compound Name | bis(4-tert-butylphenyl)-[4-(carboxymethoxy)-3,5-dimethylphenyl]sulfanium |
|---|---|
| PubChem CID | 140622341 |
| Molecular Formula | C30H37O3S+ |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | bis(4-tert-butylphenyl)-[4-(carboxymethoxy)-3,5-dimethylphenyl]sulfanium |
| SMILES | Cc1cc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(C)c1OCC(=O)O |
| InChI | InChI=1S/C30H36O3S/c1-20-17-26(18-21(2)28(20)33-19-27(31)32)34(24-13-9-22(10-14-24)29(3,4)5)25-15-11-23(12-16-25)30(6,7)8/h9-18H,19H2,1-8H3/p+1 |
| InChIKey | GSNFKKWIOVPMMP-UHFFFAOYSA-O |
| XLogP | 7.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|