C37H35O3S+ — CID 169017224
[3,5-dimethyl-4-[2-(1-naphthalen-1-ylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017224) has the molecular formula C37H35O3S+ and a molecular weight of 559.75 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-(1-naphthalen-1-ylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-(1-naphthalen-1-ylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017224 |
| Molecular Formula | C37H35O3S+ |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | [3,5-dimethyl-4-[2-(1-naphthalen-1-ylcyclopentyl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC1(c2cccc3ccccc23)CCCC1 |
| InChI | InChI=1S/C37H35O3S/c1-27-24-32(41(30-16-5-3-6-17-30)31-18-7-4-8-19-31)25-28(2)36(27)39-26-35(38)40-37(22-11-12-23-37)34-21-13-15-29-14-9-10-20-33(29)34/h3-10,13-21,24-25H,11-12,22-23,26H2,1-2H3/q+1 |
| InChIKey | OOFNOAYYIMHOBX-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|