C30H29F2O3S+ — CID 169017799
[1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169017799) has the molecular formula C30H29F2O3S+ and a molecular weight of 507.62 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169017799 |
| Molecular Formula | C30H29F2O3S+ |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [1-(3,4-difluorophenyl)cyclopentyl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc(-[s+]2c(C)cc3ccccc32)cc(C)c1OCC(=O)OC1(c2ccc(F)c(F)c2)CCCC1 |
| InChI | InChI=1S/C30H29F2O3S/c1-19-14-24(36-21(3)16-22-8-4-5-9-27(22)36)15-20(2)29(19)34-18-28(33)35-30(12-6-7-13-30)23-10-11-25(31)26(32)17-23/h4-5,8-11,14-17H,6-7,12-13,18H2,1-3H3/q+1 |
| InChIKey | XHMOJGYWODLKOT-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|