C28H29O4S+ — CID 156684219
(1-methylcyclopentyl) 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate (PubChem CID 156684219) has the molecular formula C28H29O4S+ and a molecular weight of 461.60 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate.
| Compound Name | (1-methylcyclopentyl) 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate |
|---|---|
| PubChem CID | 156684219 |
| Molecular Formula | C28H29O4S+ |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (1-methylcyclopentyl) 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate |
| SMILES | Cc1cc([S+]2c3ccccc3Oc3ccccc32)cc(C)c1OCC(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C28H29O4S/c1-19-16-21(17-20(2)27(19)30-18-26(29)32-28(3)14-8-9-15-28)33-24-12-6-4-10-22(24)31-23-11-5-7-13-25(23)33/h4-7,10-13,16-17H,8-9,14-15,18H2,1-3H3/q+1 |
| InChIKey | KSBCXNLZTIZPIQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|