C24H21O3S+ — CID 147497962
(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenyl) 2-methylprop-2-enoate (PubChem CID 147497962) has the molecular formula C24H21O3S+ and a molecular weight of 389.50 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenyl) 2-methylprop-2-enoate.
| Compound Name | (2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147497962 |
| Molecular Formula | C24H21O3S+ |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)cc([S+]2c3ccccc3Oc3ccccc32)cc1C |
| InChI | InChI=1S/C24H21O3S/c1-15(2)24(25)27-23-16(3)13-18(14-17(23)4)28-21-11-7-5-9-19(21)26-20-10-6-8-12-22(20)28/h5-14H,1H2,2-4H3/q+1 |
| InChIKey | FGVTWMPQRVLEPK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|