C26H27O4S+ — CID 140796177
tert-butyl 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate (PubChem CID 140796177) has the molecular formula C26H27O4S+ and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate.
| Compound Name | tert-butyl 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate |
|---|---|
| PubChem CID | 140796177 |
| Molecular Formula | C26H27O4S+ |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | tert-butyl 2-(2,6-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)acetate |
| SMILES | Cc1cc([S+]2c3ccccc3Oc3ccccc32)cc(C)c1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H27O4S/c1-17-14-19(15-18(2)25(17)28-16-24(27)30-26(3,4)5)31-22-12-8-6-10-20(22)29-21-11-7-9-13-23(21)31/h6-15H,16H2,1-5H3/q+1 |
| InChIKey | MHMMUFJIMJLSKP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|