C20H23O3S+ — CID 169051422
2-methylpent-3-yn-2-yl 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate (PubChem CID 169051422) has the molecular formula C20H23O3S+ and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-methylpent-3-yn-2-yl 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate.
| Compound Name | 2-methylpent-3-yn-2-yl 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate |
|---|---|
| PubChem CID | 169051422 |
| Molecular Formula | C20H23O3S+ |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-methylpent-3-yn-2-yl 2-(2,6-dimethyl-4-thiophen-1-ium-1-ylphenoxy)acetate |
| SMILES | CC#CC(C)(C)OC(=O)COc1c(C)cc(-[s+]2cccc2)cc1C |
| InChI | InChI=1S/C20H23O3S/c1-6-9-20(4,5)23-18(21)14-22-19-15(2)12-17(13-16(19)3)24-10-7-8-11-24/h7-8,10-13H,14H2,1-5H3/q+1 |
| InChIKey | YJRVMSKTHQPEJV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|