C30H28ClO3S+ — CID 169050537
[4-(2-chlorophenyl)-2-methylbut-3-yn-2-yl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169050537) has the molecular formula C30H28ClO3S+ and a molecular weight of 504.07 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-2-methylbut-3-yn-2-yl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | [4-(2-chlorophenyl)-2-methylbut-3-yn-2-yl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169050537 |
| Molecular Formula | C30H28ClO3S+ |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [4-(2-chlorophenyl)-2-methylbut-3-yn-2-yl] 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc(-[s+]2c(C)cc3ccccc32)cc(C)c1OCC(=O)OC(C)(C)C#Cc1ccccc1Cl |
| InChI | InChI=1S/C30H28ClO3S/c1-20-16-25(35-22(3)18-24-11-7-9-13-27(24)35)17-21(2)29(20)33-19-28(32)34-30(4,5)15-14-23-10-6-8-12-26(23)31/h6-13,16-18H,19H2,1-5H3/q+1 |
| InChIKey | GHNOHJNTSQNKAJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|