C31H29O3S+ — CID 169050660
(3-methyl-5-phenylpent-1-en-4-yn-3-yl) 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate (PubChem CID 169050660) has the molecular formula C31H29O3S+ and a molecular weight of 481.64 g/mol. Its IUPAC name is (3-methyl-5-phenylpent-1-en-4-yn-3-yl) 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate.
| Compound Name | (3-methyl-5-phenylpent-1-en-4-yn-3-yl) 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169050660 |
| Molecular Formula | C31H29O3S+ |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (3-methyl-5-phenylpent-1-en-4-yn-3-yl) 2-[2,6-dimethyl-4-(2-methyl-1-benzothiophen-1-ium-1-yl)phenoxy]acetate |
| SMILES | C=CC(C)(C#Cc1ccccc1)OC(=O)COc1c(C)cc(-[s+]2c(C)cc3ccccc32)cc1C |
| InChI | InChI=1S/C31H29O3S/c1-6-31(5,17-16-25-12-8-7-9-13-25)34-29(32)21-33-30-22(2)18-27(19-23(30)3)35-24(4)20-26-14-10-11-15-28(26)35/h6-15,18-20H,1,21H2,2-5H3/q+1 |
| InChIKey | XJTDTPSSLDBUGN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|