C31H28NO5S+ — CID 169017081
2-(4-nitrophenyl)propan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate (PubChem CID 169017081) has the molecular formula C31H28NO5S+ and a molecular weight of 526.63 g/mol. Its IUPAC name is 2-(4-nitrophenyl)propan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate.
| Compound Name | 2-(4-nitrophenyl)propan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 169017081 |
| Molecular Formula | C31H28NO5S+ |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-(4-nitrophenyl)propan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1OCC(=O)OC(C)(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H28NO5S/c1-20-17-24(38-27-11-7-5-9-25(27)26-10-6-8-12-28(26)38)18-21(2)30(20)36-19-29(33)37-31(3,4)22-13-15-23(16-14-22)32(34)35/h5-18H,19H2,1-4H3/q+1 |
| InChIKey | XSMWSWSIGPSOKR-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|