C41H39FNO8S+ — CID 169017848
[3-[2-[2-(4-fluorophenyl)propan-2-yloxy]-2-oxoethoxy]-4-methyl-5-[2-[2-(4-nitrophenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017848) has the molecular formula C41H39FNO8S+ and a molecular weight of 724.83 g/mol. Its IUPAC name is [3-[2-[2-(4-fluorophenyl)propan-2-yloxy]-2-oxoethoxy]-4-methyl-5-[2-[2-(4-nitrophenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3-[2-[2-(4-fluorophenyl)propan-2-yloxy]-2-oxoethoxy]-4-methyl-5-[2-[2-(4-nitrophenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017848 |
| Molecular Formula | C41H39FNO8S+ |
| Molecular Weight | 724.83 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | [3-[2-[2-(4-fluorophenyl)propan-2-yloxy]-2-oxoethoxy]-4-methyl-5-[2-[2-(4-nitrophenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1c(OCC(=O)OC(C)(C)c2ccc(F)cc2)cc([S+](c2ccccc2)c2ccccc2)cc1OCC(=O)OC(C)(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C41H39FNO8S/c1-28-36(48-26-38(44)50-40(2,3)29-16-20-31(42)21-17-29)24-35(52(33-12-8-6-9-13-33)34-14-10-7-11-15-34)25-37(28)49-27-39(45)51-41(4,5)30-18-22-32(23-19-30)43(46)47/h6-25H,26-27H2,1-5H3/q+1 |
| InChIKey | ZXTBUNONLFMAHY-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.83 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|