C30H29O4S+ — CID 169017332
[3-[2-[2-(4-methoxyphenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169017332) has the molecular formula C30H29O4S+ and a molecular weight of 485.63 g/mol. Its IUPAC name is [3-[2-[2-(4-methoxyphenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3-[2-[2-(4-methoxyphenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169017332 |
| Molecular Formula | C30H29O4S+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [3-[2-[2-(4-methoxyphenyl)propan-2-yloxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | COc1ccc(C(C)(C)OC(=O)COc2cccc([S+](c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H29O4S/c1-30(2,23-17-19-24(32-3)20-18-23)34-29(31)22-33-25-11-10-16-28(21-25)35(26-12-6-4-7-13-26)27-14-8-5-9-15-27/h4-21H,22H2,1-3H3/q+1 |
| InChIKey | QGFWTWUHRXLSPC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|