C28H25FNO3S+ — CID 169017324
(4-fluorophenyl)-[4-[2-oxo-2-(2-pyridin-4-ylpropan-2-yloxy)ethoxy]phenyl]-phenylsulfanium (PubChem CID 169017324) has the molecular formula C28H25FNO3S+ and a molecular weight of 474.58 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[2-oxo-2-(2-pyridin-4-ylpropan-2-yloxy)ethoxy]phenyl]-phenylsulfanium.
| Compound Name | (4-fluorophenyl)-[4-[2-oxo-2-(2-pyridin-4-ylpropan-2-yloxy)ethoxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 169017324 |
| Molecular Formula | C28H25FNO3S+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (4-fluorophenyl)-[4-[2-oxo-2-(2-pyridin-4-ylpropan-2-yloxy)ethoxy]phenyl]-phenylsulfanium |
| SMILES | CC(C)(OC(=O)COc1ccc([S+](c2ccccc2)c2ccc(F)cc2)cc1)c1ccncc1 |
| InChI | InChI=1S/C28H25FNO3S/c1-28(2,21-16-18-30-19-17-21)33-27(31)20-32-23-10-14-26(15-11-23)34(24-6-4-3-5-7-24)25-12-8-22(29)9-13-25/h3-19H,20H2,1-2H3/q+1 |
| InChIKey | ACXCVFAZQXSGKV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|