C31H26FO3S+ — CID 169050822
[4-[2-[4-(2-fluorophenyl)-2-methylbut-3-yn-2-yl]oxy-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 169050822) has the molecular formula C31H26FO3S+ and a molecular weight of 497.61 g/mol. Its IUPAC name is [4-[2-[4-(2-fluorophenyl)-2-methylbut-3-yn-2-yl]oxy-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[4-(2-fluorophenyl)-2-methylbut-3-yn-2-yl]oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 169050822 |
| Molecular Formula | C31H26FO3S+ |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [4-[2-[4-(2-fluorophenyl)-2-methylbut-3-yn-2-yl]oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C#Cc1ccccc1F)OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26FO3S/c1-31(2,22-21-24-11-9-10-16-29(24)32)35-30(33)23-34-25-17-19-28(20-18-25)36(26-12-5-3-6-13-26)27-14-7-4-8-15-27/h3-20H,23H2,1-2H3/q+1 |
| InChIKey | LOWOAODIWMUYAG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|