C30H35O8S+ — CID 59503276
bis[4-[(2-methylpropan-2-yl)oxycarbonyloxymethoxy]phenyl]-phenylsulfanium (PubChem CID 59503276) has the molecular formula C30H35O8S+ and a molecular weight of 555.67 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxycarbonyloxymethoxy]phenyl]-phenylsulfanium.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxycarbonyloxymethoxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 59503276 |
| Molecular Formula | C30H35O8S+ |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxycarbonyloxymethoxy]phenyl]-phenylsulfanium |
| SMILES | CC(C)(C)OC(=O)OCOc1ccc([S+](c2ccccc2)c2ccc(OCOC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H35O8S/c1-29(2,3)37-27(31)35-20-33-22-12-16-25(17-13-22)39(24-10-8-7-9-11-24)26-18-14-23(15-19-26)34-21-36-28(32)38-30(4,5)6/h7-19H,20-21H2,1-6H3/q+1 |
| InChIKey | NILZPGPQONZECF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|