C23H25OS+ — CID 160615561
[4-(2,2-dimethylpropoxy)phenyl]-diphenylsulfanium (PubChem CID 160615561) has the molecular formula C23H25OS+ and a molecular weight of 349.52 g/mol. Its IUPAC name is [4-(2,2-dimethylpropoxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(2,2-dimethylpropoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 160615561 |
| Molecular Formula | C23H25OS+ |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [4-(2,2-dimethylpropoxy)phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25OS/c1-23(2,3)18-24-19-14-16-22(17-15-19)25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,18H2,1-3H3/q+1 |
| InChIKey | RRIIUBFYPUHEQV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|