C19H24O2 — CID 71219491
1-(2,2-dimethylpropoxy)-4-[methoxy(phenyl)methyl]benzene (PubChem CID 71219491) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(2,2-dimethylpropoxy)-4-[methoxy(phenyl)methyl]benzene.
| Compound Name | 1-(2,2-dimethylpropoxy)-4-[methoxy(phenyl)methyl]benzene |
|---|---|
| PubChem CID | 71219491 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(2,2-dimethylpropoxy)-4-[methoxy(phenyl)methyl]benzene |
| SMILES | COC(c1ccccc1)c1ccc(OCC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24O2/c1-19(2,3)14-21-17-12-10-16(11-13-17)18(20-4)15-8-6-5-7-9-15/h5-13,18H,14H2,1-4H3 |
| InChIKey | UWCWSDUAXIZBRN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |