C15H24O — CID 70425921
2,2,4,4-tetramethylpentoxybenzene (PubChem CID 70425921) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentoxybenzene.
| Compound Name | 2,2,4,4-tetramethylpentoxybenzene |
|---|---|
| PubChem CID | 70425921 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2,2,4,4-tetramethylpentoxybenzene |
| SMILES | CC(C)(C)CC(C)(C)COc1ccccc1 |
| InChI | InChI=1S/C15H24O/c1-14(2,3)11-15(4,5)12-16-13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3 |
| InChIKey | QOTSOCPZXPBFTQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |