C17H19BrO — CID 64995461
1-(3-bromo-2,2-dimethylpropoxy)-4-phenylbenzene (PubChem CID 64995461) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-(3-bromo-2,2-dimethylpropoxy)-4-phenylbenzene.
| Compound Name | 1-(3-bromo-2,2-dimethylpropoxy)-4-phenylbenzene |
|---|---|
| PubChem CID | 64995461 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(3-bromo-2,2-dimethylpropoxy)-4-phenylbenzene |
| SMILES | CC(C)(CBr)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19BrO/c1-17(2,12-18)13-19-16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3 |
| InChIKey | XIOFWJPBOUKHAF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|