2,2-dimethyl-3-phenoxypropanoyl chloride

C11H13ClO2 — CID 82040727

IUPAC2,2-dimethyl-3-phenoxypropanoyl chloride
SMILESCC(C)(COc1ccccc1)C(=O)Cl
InChIInChI=1S/C11H13ClO2/c1-11(2,10(12)13)8-14-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3
InChIKeyXLKWRRJRHGBPQY-UHFFFAOYSA-N
MW212.68 g/mol
LogP2.86
Rot. Bonds4

About 2,2-dimethyl-3-phenoxypropanoyl chloride

2,2-dimethyl-3-phenoxypropanoyl chloride (PubChem CID 82040727) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 2,2-dimethyl-3-phenoxypropanoyl chloride.

Molecular Properties

Compound Name2,2-dimethyl-3-phenoxypropanoyl chloride
PubChem CID82040727
Molecular FormulaC11H13ClO2
Molecular Weight212.68 g/mol
Exact Mass212.06
IUPAC Name2,2-dimethyl-3-phenoxypropanoyl chloride
SMILESCC(C)(COc1ccccc1)C(=O)Cl
InChIInChI=1S/C11H13ClO2/c1-11(2,10(12)13)8-14-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3
InChIKeyXLKWRRJRHGBPQY-UHFFFAOYSA-N
XLogP2.86
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.68
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,2-dimethyl-3-phenoxypropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-phenoxypropanoyl chloride?
The IUPAC name of 2,2-dimethyl-3-phenoxypropanoyl chloride (CID 82040727) is 2,2-dimethyl-3-phenoxypropanoyl chloride.
What is the SMILES notation for 2,2-dimethyl-3-phenoxypropanoyl chloride?
The canonical SMILES for 2,2-dimethyl-3-phenoxypropanoyl chloride is CC(C)(COc1ccccc1)C(=O)Cl.
What is the InChIKey of 2,2-dimethyl-3-phenoxypropanoyl chloride?
The InChIKey is XLKWRRJRHGBPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO2/c1-11(2,10(12)13)8-14-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of 2,2-dimethyl-3-phenoxypropanoyl chloride?
2,2-dimethyl-3-phenoxypropanoyl chloride has a molecular weight of 212.68 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-phenoxypropanoyl chloride is sourced from PubChem (CID 82040727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).