C13H18O4 — CID 79623125
2,2-dimethyl-3-(2-phenoxyethoxy)propanoic acid (PubChem CID 79623125) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-phenoxyethoxy)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(2-phenoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 79623125 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2,2-dimethyl-3-(2-phenoxyethoxy)propanoic acid |
| SMILES | CC(C)(COCCOc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-13(2,12(14)15)10-16-8-9-17-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,14,15) |
| InChIKey | MPIBSDWWVKQTRI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|