C24H40O9S2Zn — CID 156674376
3-(2-ethoxyethylsulfanyl)propanoic acid;3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propanoic acid;zinc (PubChem CID 156674376) has the molecular formula C24H40O9S2Zn and a molecular weight of 602.10 g/mol. Its IUPAC name is 3-(2-ethoxyethylsulfanyl)propanoic acid;3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propanoic acid;zinc.
| Compound Name | 3-(2-ethoxyethylsulfanyl)propanoic acid;3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propanoic acid;zinc |
|---|---|
| PubChem CID | 156674376 |
| Molecular Formula | C24H40O9S2Zn |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 3-(2-ethoxyethylsulfanyl)propanoic acid;3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propanoic acid;zinc |
| SMILES | CCOCCSCCC(=O)O.O=C(O)CCSCCOCCOCCOCCOc1ccccc1.[Zn] |
| InChI | InChI=1S/C17H26O6S.C7H14O3S.Zn/c18-17(19)6-14-24-15-13-22-10-9-20-7-8-21-11-12-23-16-4-2-1-3-5-16;1-2-10-4-6-11-5-3-7(8)9;/h1-5H,6-15H2,(H,18,19);2-6H2,1H3,(H,8,9); |
| InChIKey | UDIOXUXPDPQTRN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|