C13H20O4 — CID 174652454
benzene;3-(2-ethoxyethoxy)propanoic acid (PubChem CID 174652454) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is benzene;3-(2-ethoxyethoxy)propanoic acid.
| Compound Name | benzene;3-(2-ethoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 174652454 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | benzene;3-(2-ethoxyethoxy)propanoic acid |
| SMILES | CCOCCOCCC(=O)O.c1ccccc1 |
| InChI | InChI=1S/C7H14O4.C6H6/c1-2-10-5-6-11-4-3-7(8)9;1-2-4-6-5-3-1/h2-6H2,1H3,(H,8,9);1-6H |
| InChIKey | JKFVYXFOCNSDOE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|