About 8-ethoxy-6-oxooctanoic acid
8-ethoxy-6-oxooctanoic acid (PubChem CID 154310113) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 8-ethoxy-6-oxooctanoic acid.
Molecular Properties
| Compound Name | 8-ethoxy-6-oxooctanoic acid |
| PubChem CID | 154310113 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 8-ethoxy-6-oxooctanoic acid |
| SMILES | CCOCCC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-2-14-8-7-9(11)5-3-4-6-10(12)13/h2-8H2,1H3,(H,12,13) |
| InChIKey | SBIUENHKIAQVPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-ethoxy-6-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxy-6-oxooctanoic acid?
The IUPAC name of 8-ethoxy-6-oxooctanoic acid (CID 154310113) is 8-ethoxy-6-oxooctanoic acid.
What is the SMILES notation for 8-ethoxy-6-oxooctanoic acid?
The canonical SMILES for 8-ethoxy-6-oxooctanoic acid is CCOCCC(=O)CCCCC(=O)O.
What is the InChIKey of 8-ethoxy-6-oxooctanoic acid?
The InChIKey is SBIUENHKIAQVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-2-14-8-7-9(11)5-3-4-6-10(12)13/h2-8H2,1H3,(H,12,13).
What are the key properties of 8-ethoxy-6-oxooctanoic acid?
8-ethoxy-6-oxooctanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.63, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxy-6-oxooctanoic acid is sourced from PubChem (CID 154310113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).