About 1,9-diethoxynonan-5-one
1,9-diethoxynonan-5-one (PubChem CID 150666797) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,9-diethoxynonan-5-one.
Molecular Properties
| Compound Name | 1,9-diethoxynonan-5-one |
| PubChem CID | 150666797 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 1,9-diethoxynonan-5-one |
| SMILES | CCOCCCCC(=O)CCCCOCC |
| InChI | InChI=1S/C13H26O3/c1-3-15-11-7-5-9-13(14)10-6-8-12-16-4-2/h3-12H2,1-2H3 |
| InChIKey | JFARTOMDRPYKNQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,9-diethoxynonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-diethoxynonan-5-one?
The IUPAC name of 1,9-diethoxynonan-5-one (CID 150666797) is 1,9-diethoxynonan-5-one.
What is the SMILES notation for 1,9-diethoxynonan-5-one?
The canonical SMILES for 1,9-diethoxynonan-5-one is CCOCCCCC(=O)CCCCOCC.
What is the InChIKey of 1,9-diethoxynonan-5-one?
The InChIKey is JFARTOMDRPYKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-3-15-11-7-5-9-13(14)10-6-8-12-16-4-2/h3-12H2,1-2H3.
What are the key properties of 1,9-diethoxynonan-5-one?
1,9-diethoxynonan-5-one has a molecular weight of 230.35 g/mol, XLogP of 2.97, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-diethoxynonan-5-one is sourced from PubChem (CID 150666797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).