About 5-ethoxypentaneperoxoic acid
5-ethoxypentaneperoxoic acid (PubChem CID 59169108) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-ethoxypentaneperoxoic acid.
Molecular Properties
| Compound Name | 5-ethoxypentaneperoxoic acid |
| PubChem CID | 59169108 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-ethoxypentaneperoxoic acid |
| SMILES | CCOCCCCC(=O)OO |
| InChI | InChI=1S/C7H14O4/c1-2-10-6-4-3-5-7(8)11-9/h9H,2-6H2,1H3 |
| InChIKey | IWKCPLZRARAETQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxypentaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxypentaneperoxoic acid?
The IUPAC name of 5-ethoxypentaneperoxoic acid (CID 59169108) is 5-ethoxypentaneperoxoic acid.
What is the SMILES notation for 5-ethoxypentaneperoxoic acid?
The canonical SMILES for 5-ethoxypentaneperoxoic acid is CCOCCCCC(=O)OO.
What is the InChIKey of 5-ethoxypentaneperoxoic acid?
The InChIKey is IWKCPLZRARAETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-2-10-6-4-3-5-7(8)11-9/h9H,2-6H2,1H3.
What are the key properties of 5-ethoxypentaneperoxoic acid?
5-ethoxypentaneperoxoic acid has a molecular weight of 162.19 g/mol, XLogP of 1.21, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxypentaneperoxoic acid is sourced from PubChem (CID 59169108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).