C18H20ClNO3 — CID 134104626
N-[(2-chlorophenyl)methyl]-N-hydroxy-2,2-dimethyl-3-phenoxypropanamide (PubChem CID 134104626) has the molecular formula C18H20ClNO3 and a molecular weight of 333.81 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-hydroxy-2,2-dimethyl-3-phenoxypropanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-hydroxy-2,2-dimethyl-3-phenoxypropanamide |
|---|---|
| PubChem CID | 134104626 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-hydroxy-2,2-dimethyl-3-phenoxypropanamide |
| SMILES | CC(C)(COc1ccccc1)C(=O)N(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClNO3/c1-18(2,13-23-15-9-4-3-5-10-15)17(21)20(22)12-14-8-6-7-11-16(14)19/h3-11,22H,12-13H2,1-2H3 |
| InChIKey | FGDNIDPHOXUICP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|