C13H17ClN2O3 — CID 54413851
[(2-chlorophenyl)methyl-(2,2-dimethylpropanoyl)amino] carbamate (PubChem CID 54413851) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is [(2-chlorophenyl)methyl-(2,2-dimethylpropanoyl)amino] carbamate.
| Compound Name | [(2-chlorophenyl)methyl-(2,2-dimethylpropanoyl)amino] carbamate |
|---|---|
| PubChem CID | 54413851 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(2-chlorophenyl)methyl-(2,2-dimethylpropanoyl)amino] carbamate |
| SMILES | CC(C)(C)C(=O)N(Cc1ccccc1Cl)OC(N)=O |
| InChI | InChI=1S/C13H17ClN2O3/c1-13(2,3)11(17)16(19-12(15)18)8-9-6-4-5-7-10(9)14/h4-7H,8H2,1-3H3,(H2,15,18) |
| InChIKey | VVZMDZHOKHPVPZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|