C15H16Cl5NO4 — CID 13192538
[(3-chloro-2,2-dimethylpropanoyl)-[(2-chlorophenyl)methyl]amino] 2,2,2-trichloroethyl carbonate (PubChem CID 13192538) has the molecular formula C15H16Cl5NO4 and a molecular weight of 451.56 g/mol. Its IUPAC name is [(3-chloro-2,2-dimethylpropanoyl)-[(2-chlorophenyl)methyl]amino] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(3-chloro-2,2-dimethylpropanoyl)-[(2-chlorophenyl)methyl]amino] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 13192538 |
| Molecular Formula | C15H16Cl5NO4 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | [(3-chloro-2,2-dimethylpropanoyl)-[(2-chlorophenyl)methyl]amino] 2,2,2-trichloroethyl carbonate |
| SMILES | CC(C)(CCl)C(=O)N(Cc1ccccc1Cl)OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16Cl5NO4/c1-14(2,8-16)12(22)21(7-10-5-3-4-6-11(10)17)25-13(23)24-9-15(18,19)20/h3-6H,7-9H2,1-2H3 |
| InChIKey | QEBUEBAZVVLJIK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|