C14H16Br2ClNO3 — CID 13192562
[(3-bromo-2,2-dimethylpropanoyl)-[(2-bromophenyl)methyl]amino] 2-chloroacetate (PubChem CID 13192562) has the molecular formula C14H16Br2ClNO3 and a molecular weight of 441.55 g/mol. Its IUPAC name is [(3-bromo-2,2-dimethylpropanoyl)-[(2-bromophenyl)methyl]amino] 2-chloroacetate.
| Compound Name | [(3-bromo-2,2-dimethylpropanoyl)-[(2-bromophenyl)methyl]amino] 2-chloroacetate |
|---|---|
| PubChem CID | 13192562 |
| Molecular Formula | C14H16Br2ClNO3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | [(3-bromo-2,2-dimethylpropanoyl)-[(2-bromophenyl)methyl]amino] 2-chloroacetate |
| SMILES | CC(C)(CBr)C(=O)N(Cc1ccccc1Br)OC(=O)CCl |
| InChI | InChI=1S/C14H16Br2ClNO3/c1-14(2,9-15)13(20)18(21-12(19)7-17)8-10-5-3-4-6-11(10)16/h3-6H,7-9H2,1-2H3 |
| InChIKey | CCKNFVHQMOTSCJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|