C15H21BrO3 — CID 118947551
tert-butyl 2-[3-(2-bromophenyl)propoxy]acetate (PubChem CID 118947551) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is tert-butyl 2-[3-(2-bromophenyl)propoxy]acetate.
| Compound Name | tert-butyl 2-[3-(2-bromophenyl)propoxy]acetate |
|---|---|
| PubChem CID | 118947551 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | tert-butyl 2-[3-(2-bromophenyl)propoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCc1ccccc1Br |
| InChI | InChI=1S/C15H21BrO3/c1-15(2,3)19-14(17)11-18-10-6-8-12-7-4-5-9-13(12)16/h4-5,7,9H,6,8,10-11H2,1-3H3 |
| InChIKey | SGTYPBRKWRUSHB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|