C19H29BrN2O2 — CID 169408791
tert-butyl (2R)-4-[3-(2-bromophenyl)propyl]-2-methylpiperazine-1-carboxylate (PubChem CID 169408791) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is tert-butyl (2R)-4-[3-(2-bromophenyl)propyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[3-(2-bromophenyl)propyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 169408791 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | tert-butyl (2R)-4-[3-(2-bromophenyl)propyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(CCCc2ccccc2Br)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29BrN2O2/c1-15-14-21(11-7-9-16-8-5-6-10-17(16)20)12-13-22(15)18(23)24-19(2,3)4/h5-6,8,10,15H,7,9,11-14H2,1-4H3/t15-/m1/s1 |
| InChIKey | CKXMHZZQICWGHJ-OAHLLOKOSA-N |
| XLogP | 4.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |