C27H46N2O6 — CID 166459954
benzyl formate;tert-butyl 4-(3,3-dimethylpentyl)-2-methylpiperazine-1-carboxylate;methyl formate (PubChem CID 166459954) has the molecular formula C27H46N2O6 and a molecular weight of 494.67 g/mol. Its IUPAC name is benzyl formate;tert-butyl 4-(3,3-dimethylpentyl)-2-methylpiperazine-1-carboxylate;methyl formate.
| Compound Name | benzyl formate;tert-butyl 4-(3,3-dimethylpentyl)-2-methylpiperazine-1-carboxylate;methyl formate |
|---|---|
| PubChem CID | 166459954 |
| Molecular Formula | C27H46N2O6 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | benzyl formate;tert-butyl 4-(3,3-dimethylpentyl)-2-methylpiperazine-1-carboxylate;methyl formate |
| SMILES | CCC(C)(C)CCN1CCN(C(=O)OC(C)(C)C)C(C)C1.COC=O.O=COCc1ccccc1 |
| InChI | InChI=1S/C17H34N2O2.C8H8O2.C2H4O2/c1-8-17(6,7)9-10-18-11-12-19(14(2)13-18)15(20)21-16(3,4)5;9-7-10-6-8-4-2-1-3-5-8;1-4-2-3/h14H,8-13H2,1-7H3;1-5,7H,6H2;2H,1H3 |
| InChIKey | FDYIZGGIQYDUJS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|