C19H28N2O4 — CID 174989851
tert-butyl 4-[(4-methoxycarbonylphenyl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 174989851) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is tert-butyl 4-[(4-methoxycarbonylphenyl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methoxycarbonylphenyl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174989851 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | tert-butyl 4-[(4-methoxycarbonylphenyl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCN(C(=O)OC(C)(C)C)C(C)C2)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-14-12-20(10-11-21(14)18(23)25-19(2,3)4)13-15-6-8-16(9-7-15)17(22)24-5/h6-9,14H,10-13H2,1-5H3 |
| InChIKey | MHKVFRNIXYUZMR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |