About tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate
tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate (PubChem CID 145386490) has the molecular formula C28H37N3O5
and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate |
| PubChem CID | 145386490 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate |
| SMILES | CC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C.COC(=O)c1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C17H26N2O2.C11H11NO3/c1-14-12-18(13-15-8-6-5-7-9-15)10-11-19(14)16(20)21-17(2,3)4;1-12-6-8-4-3-7(11(14)15-2)5-9(8)10(12)13/h5-9,14H,10-13H2,1-4H3;3-5H,6H2,1-2H3 |
| InChIKey | FIAFLRYIQCAXRQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate?
The IUPAC name of tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate (CID 145386490) is tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate.
What is the SMILES notation for tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate?
The canonical SMILES for tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate is CC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C.COC(=O)c1ccc2c(c1)C(=O)N(C)C2.
What is the InChIKey of tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate?
The InChIKey is FIAFLRYIQCAXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2.C11H11NO3/c1-14-12-18(13-15-8-6-5-7-9-15)10-11-19(14)16(20)21-17(2,3)4;1-12-6-8-4-3-7(11(14)15-2)5-9(8)10(12)13/h5-9,14H,10-13H2,1-4H3;3-5H,6H2,1-2H3.
What are the key properties of tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate?
tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate has a molecular weight of 495.62 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-benzyl-2-methylpiperazine-1-carboxylate;methyl 2-methyl-3-oxo-1H-isoindole-5-carboxylate is sourced from PubChem (CID 145386490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).