C25H33IN2O4 — CID 176508059
tert-butyl (2R)-4-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 176508059) has the molecular formula C25H33IN2O4 and a molecular weight of 552.45 g/mol. Its IUPAC name is tert-butyl (2R)-4-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176508059 |
| Molecular Formula | C25H33IN2O4 |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | tert-butyl (2R)-4-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | COc1cc(CN2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H33IN2O4/c1-18-15-27(11-12-28(18)24(29)32-25(2,3)4)16-20-13-21(26)23(22(14-20)30-5)31-17-19-9-7-6-8-10-19/h6-10,13-14,18H,11-12,15-17H2,1-5H3/t18-/m1/s1 |
| InChIKey | AAPKMODZVUBXAT-GOSISDBHSA-N |
| XLogP | 5.32 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|