C17H24BrFN2O2 — CID 139292203
tert-butyl 4-[(3-bromo-5-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 139292203) has the molecular formula C17H24BrFN2O2 and a molecular weight of 387.29 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromo-5-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-bromo-5-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 139292203 |
| Molecular Formula | C17H24BrFN2O2 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | tert-butyl 4-[(3-bromo-5-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(Cc2cc(F)cc(Br)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24BrFN2O2/c1-12-10-20(11-13-7-14(18)9-15(19)8-13)5-6-21(12)16(22)23-17(2,3)4/h7-9,12H,5-6,10-11H2,1-4H3 |
| InChIKey | JKBNQQZOUWCYCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |