C16H26N4O2S — CID 97168480
tert-butyl (2R)-2-methyl-4-[(3-methylsulfanylpyrazin-2-yl)methyl]piperazine-1-carboxylate (PubChem CID 97168480) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-4-[(3-methylsulfanylpyrazin-2-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-4-[(3-methylsulfanylpyrazin-2-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 97168480 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl (2R)-2-methyl-4-[(3-methylsulfanylpyrazin-2-yl)methyl]piperazine-1-carboxylate |
| SMILES | CSc1nccnc1CN1CCN(C(=O)OC(C)(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C16H26N4O2S/c1-12-10-19(11-13-14(23-5)18-7-6-17-13)8-9-20(12)15(21)22-16(2,3)4/h6-7,12H,8-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | UICQMMBQBBDFSD-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |