C15H23BrN2O2S — CID 168509822
tert-butyl (2R)-4-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 168509822) has the molecular formula C15H23BrN2O2S and a molecular weight of 375.33 g/mol. Its IUPAC name is tert-butyl (2R)-4-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168509822 |
| Molecular Formula | C15H23BrN2O2S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | tert-butyl (2R)-4-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(Cc2cc(Br)cs2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23BrN2O2S/c1-11-8-17(9-13-7-12(16)10-21-13)5-6-18(11)14(19)20-15(2,3)4/h7,10-11H,5-6,8-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | JRACUIAEXQKSIP-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |