C20H31N3O2S — CID 145440596
tert-butyl (2S)-4-[[2,5-dimethyl-3-(thiaziridin-2-yl)phenyl]methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 145440596) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is tert-butyl (2S)-4-[[2,5-dimethyl-3-(thiaziridin-2-yl)phenyl]methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[[2,5-dimethyl-3-(thiaziridin-2-yl)phenyl]methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 145440596 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | tert-butyl (2S)-4-[[2,5-dimethyl-3-(thiaziridin-2-yl)phenyl]methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | Cc1cc(CN2CCN(C(=O)OC(C)(C)C)[C@@H](C)C2)c(C)c(N2CS2)c1 |
| InChI | InChI=1S/C20H31N3O2S/c1-14-9-17(16(3)18(10-14)23-13-26-23)12-21-7-8-22(15(2)11-21)19(24)25-20(4,5)6/h9-10,15H,7-8,11-13H2,1-6H3/t15-,23?/m0/s1 |
| InChIKey | PWFVTDLJVTYUMU-NGMICRHFSA-N |
| XLogP | 4.17 |
| TPSA | 35.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|