C25H31ClFN3O4 — CID 157125771
tert-butyl (2S)-4-[[5-chloro-3-[2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-2-oxoethyl]-2-methylphenyl]methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 157125771) has the molecular formula C25H31ClFN3O4 and a molecular weight of 491.99 g/mol. Its IUPAC name is tert-butyl (2S)-4-[[5-chloro-3-[2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-2-oxoethyl]-2-methylphenyl]methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[[5-chloro-3-[2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-2-oxoethyl]-2-methylphenyl]methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 157125771 |
| Molecular Formula | C25H31ClFN3O4 |
| Molecular Weight | 491.99 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | tert-butyl (2S)-4-[[5-chloro-3-[2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-2-oxoethyl]-2-methylphenyl]methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | Cc1c(CC(=O)c2cc(F)c[n+]([O-])c2)cc(Cl)cc1CN1CCN(C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C25H31ClFN3O4/c1-16-12-28(6-7-30(16)24(32)34-25(3,4)5)13-19-9-21(26)8-18(17(19)2)11-23(31)20-10-22(27)15-29(33)14-20/h8-10,14-16H,6-7,11-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | AIMJNCALNJBFQP-INIZCTEOSA-N |
| XLogP | 4.29 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|